C18H18Cl2N2O3S — CID 1084851
(2R)-N-[(2-chlorophenyl)methyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 1084851) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is (2R)-N-[(2-chlorophenyl)methyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(2-chlorophenyl)methyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 1084851 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (2R)-N-[(2-chlorophenyl)methyl]-1-(4-chlorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)[C@H]1CCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3S/c19-14-7-9-15(10-8-14)26(24,25)22-11-3-6-17(22)18(23)21-12-13-4-1-2-5-16(13)20/h1-2,4-5,7-10,17H,3,6,11-12H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | NGONYWQTMISYQC-QGZVFWFLSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |