C17H19ClN2O3S2 — CID 92865542
(2S)-1-(4-chlorophenyl)sulfonyl-N-(thiophen-2-ylmethyl)piperidine-2-carboxamide (PubChem CID 92865542) has the molecular formula C17H19ClN2O3S2 and a molecular weight of 398.94 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenyl)sulfonyl-N-(thiophen-2-ylmethyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-(4-chlorophenyl)sulfonyl-N-(thiophen-2-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 92865542 |
| Molecular Formula | C17H19ClN2O3S2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | (2S)-1-(4-chlorophenyl)sulfonyl-N-(thiophen-2-ylmethyl)piperidine-2-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@@H]1CCCCN1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O3S2/c18-13-6-8-15(9-7-13)25(22,23)20-10-2-1-5-16(20)17(21)19-12-14-4-3-11-24-14/h3-4,6-9,11,16H,1-2,5,10,12H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | HZDZAVUXMYHXPG-INIZCTEOSA-N |
| XLogP | 3.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |