C15H20O4 — CID 10849218
(1S,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane]-2'-one (PubChem CID 10849218) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1S,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane]-2'-one.
| Compound Name | (1S,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 10849218 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane]-2'-one |
| SMILES | CC1(C)OC[C@@H]([C@@H]2[C@@H]3C=C[C@@H](C3)[C@]23CCOC3=O)O1 |
| InChI | InChI=1S/C15H20O4/c1-14(2)18-8-11(19-14)12-9-3-4-10(7-9)15(12)5-6-17-13(15)16/h3-4,9-12H,5-8H2,1-2H3/t9-,10+,11+,12+,15-/m1/s1 |
| InChIKey | ZVMAKNRYFFQWBT-JLPNCARGSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|