C14H20O5 — CID 10849485
methyl 5-[(4S,5S)-4,5-bis(ethenyl)-2-methyl-1,3-dioxolan-2-yl]-3-oxopentanoate (PubChem CID 10849485) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 5-[(4S,5S)-4,5-bis(ethenyl)-2-methyl-1,3-dioxolan-2-yl]-3-oxopentanoate.
| Compound Name | methyl 5-[(4S,5S)-4,5-bis(ethenyl)-2-methyl-1,3-dioxolan-2-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 10849485 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl 5-[(4S,5S)-4,5-bis(ethenyl)-2-methyl-1,3-dioxolan-2-yl]-3-oxopentanoate |
| SMILES | C=C[C@@H]1OC(C)(CCC(=O)CC(=O)OC)O[C@H]1C=C |
| InChI | InChI=1S/C14H20O5/c1-5-11-12(6-2)19-14(3,18-11)8-7-10(15)9-13(16)17-4/h5-6,11-12H,1-2,7-9H2,3-4H3/t11-,12-/m0/s1 |
| InChIKey | LYXHYUCEQDVHAU-RYUDHWBXSA-N |
| XLogP | 1.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|