C17H28O5 — CID 134833047
[(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] 4-oxohexanoate (PubChem CID 134833047) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] 4-oxohexanoate.
| Compound Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] 4-oxohexanoate |
|---|---|
| PubChem CID | 134833047 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] 4-oxohexanoate |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CCC)OC(=O)CCC(=O)CC |
| InChI | InChI=1S/C17H28O5/c1-6-9-14(20-15(19)11-10-12(18)7-2)16-13(8-3)21-17(4,5)22-16/h8,13-14,16H,3,6-7,9-11H2,1-2,4-5H3/t13-,14+,16-/m0/s1 |
| InChIKey | UHHVGZUJQHZZOV-LZWOXQAQSA-N |
| XLogP | 3.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|