C19H32O6 — CID 11508708
[(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2S)-2-(methoxymethoxy)hex-5-enoate (PubChem CID 11508708) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2S)-2-(methoxymethoxy)hex-5-enoate.
| Compound Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2S)-2-(methoxymethoxy)hex-5-enoate |
|---|---|
| PubChem CID | 11508708 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2S)-2-(methoxymethoxy)hex-5-enoate |
| SMILES | C=CCC[C@H](OCOC)C(=O)O[C@H](CCC)[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C19H32O6/c1-7-10-12-16(22-13-21-6)18(20)23-15(11-8-2)17-14(9-3)24-19(4,5)25-17/h7,9,14-17H,1,3,8,10-13H2,2,4-6H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | QZNAQUUKBXVZSS-YVSFHVDLSA-N |
| XLogP | 3.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|