C23H34O6 — CID 11418326
[(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2R)-2-[(2E,4E)-hexa-2,4-dienoyl]oxyhex-5-enoate (PubChem CID 11418326) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is [(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2R)-2-[(2E,4E)-hexa-2,4-dienoyl]oxyhex-5-enoate.
| Compound Name | [(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2R)-2-[(2E,4E)-hexa-2,4-dienoyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 11418326 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butyl] (2R)-2-[(2E,4E)-hexa-2,4-dienoyl]oxyhex-5-enoate |
| SMILES | C=CCC[C@@H](OC(=O)/C=C/C=C/C)C(=O)O[C@@H](CCC)[C@@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C23H34O6/c1-7-11-13-16-20(24)26-19(15-12-8-2)22(25)27-18(14-9-3)21-17(10-4)28-23(5,6)29-21/h7-8,10-11,13,16-19,21H,2,4,9,12,14-15H2,1,3,5-6H3/b11-7+,16-13+/t17-,18+,19-,21-/m1/s1 |
| InChIKey | HZTLLWPYZXBLHE-HQQOFBPGSA-N |
| XLogP | 4.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|