C21H30O6 — CID 11545343
[(3aR,4R,7S,10E,11aS)-2,2-dimethyl-6-oxo-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-7-yl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 11545343) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(3aR,4R,7S,10E,11aS)-2,2-dimethyl-6-oxo-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-7-yl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(3aR,4R,7S,10E,11aS)-2,2-dimethyl-6-oxo-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-7-yl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 11545343 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(3aR,4R,7S,10E,11aS)-2,2-dimethyl-6-oxo-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-7-yl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)O[C@H]1CC/C=C/[C@@H]2OC(C)(C)O[C@@H]2[C@@H](CCC)OC1=O |
| InChI | InChI=1S/C21H30O6/c1-5-7-8-14-18(22)24-17-13-10-9-12-16-19(27-21(3,4)26-16)15(11-6-2)25-20(17)23/h5,7-9,12,14-17,19H,6,10-11,13H2,1-4H3/b7-5+,12-9+,14-8+/t15-,16+,17+,19-/m1/s1 |
| InChIKey | CAAFHASEXJZVMA-YLRFGFAZSA-N |
| XLogP | 3.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|