C23H32O6 — CID 11475204
[(4S,5R)-5-[(1R)-1-[(2E,4E)-hexa-2,4-dienoyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl (2E,4E)-hexa-2,4-dienoate (PubChem CID 11475204) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is [(4S,5R)-5-[(1R)-1-[(2E,4E)-hexa-2,4-dienoyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [(4S,5R)-5-[(1R)-1-[(2E,4E)-hexa-2,4-dienoyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 11475204 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [(4S,5R)-5-[(1R)-1-[(2E,4E)-hexa-2,4-dienoyl]oxypent-4-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl (2E,4E)-hexa-2,4-dienoate |
| SMILES | C=CCC[C@@H](OC(=O)/C=C/C=C/C)[C@H]1OC(C)(C)O[C@H]1COC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C23H32O6/c1-6-9-12-15-20(24)26-17-19-22(29-23(4,5)28-19)18(14-11-8-3)27-21(25)16-13-10-7-2/h6-10,12-13,15-16,18-19,22H,3,11,14,17H2,1-2,4-5H3/b9-6+,10-7+,15-12+,16-13+/t18-,19+,22-/m1/s1 |
| InChIKey | RQHOUJUOQWQQMK-MYCKXGEBSA-N |
| XLogP | 4.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|