C15H24O4 — CID 135022198
(1R,2Z,6S,12S)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-2-en-4-one (PubChem CID 135022198) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1R,2Z,6S,12S)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-2-en-4-one.
| Compound Name | (1R,2Z,6S,12S)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-2-en-4-one |
|---|---|
| PubChem CID | 135022198 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1R,2Z,6S,12S)-6,14,14-trimethyl-5,13,15-trioxabicyclo[10.3.0]pentadec-2-en-4-one |
| SMILES | C[C@H]1CCCCC[C@@H]2OC(C)(C)O[C@@H]2/C=C\C(=O)O1 |
| InChI | InChI=1S/C15H24O4/c1-11-7-5-4-6-8-12-13(9-10-14(16)17-11)19-15(2,3)18-12/h9-13H,4-8H2,1-3H3/b10-9-/t11-,12-,13+/m0/s1 |
| InChIKey | CNGLQDOYAGGHJD-AUPXKVPFSA-N |
| XLogP | 2.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |