C22H38O8 — CID 10862915
ethyl (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoate (PubChem CID 10862915) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is ethyl (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoate.
| Compound Name | ethyl (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 10862915 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | ethyl (2E,4E,8S,9S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-8,9-bis(methoxymethoxy)-6,6-dimethylnona-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C/C(C)(C)C[C@H](OCOC)[C@H](OCOC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H38O8/c1-8-26-19(23)11-9-10-12-21(2,3)13-17(27-15-24-6)20(28-16-25-7)18-14-29-22(4,5)30-18/h9-12,17-18,20H,8,13-16H2,1-7H3/b11-9+,12-10+/t17-,18+,20-/m0/s1 |
| InChIKey | XHCYLBHOZOVPSP-HLDPZALUSA-N |
| XLogP | 3.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|