C19H28O4 — CID 154170005
ethyl 5-[5,5-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)cyclopenten-1-yl]-3-methylpenta-2,4-dienoate (PubChem CID 154170005) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is ethyl 5-[5,5-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)cyclopenten-1-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | ethyl 5-[5,5-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)cyclopenten-1-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 154170005 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | ethyl 5-[5,5-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)cyclopenten-1-yl]-3-methylpenta-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C)C=CC1=C(C2(C)OCCO2)CCC1(C)C |
| InChI | InChI=1S/C19H28O4/c1-6-21-17(20)13-14(2)7-8-15-16(9-10-18(15,3)4)19(5)22-11-12-23-19/h7-8,13H,6,9-12H2,1-5H3 |
| InChIKey | XRFRNAZRUCRXLL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|