C17H28O6 — CID 11558952
(3aR,4R,7S,10E,11aS)-7-(methoxymethoxy)-2,2-dimethyl-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one (PubChem CID 11558952) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3aR,4R,7S,10E,11aS)-7-(methoxymethoxy)-2,2-dimethyl-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one.
| Compound Name | (3aR,4R,7S,10E,11aS)-7-(methoxymethoxy)-2,2-dimethyl-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
|---|---|
| PubChem CID | 11558952 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3aR,4R,7S,10E,11aS)-7-(methoxymethoxy)-2,2-dimethyl-4-propyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
| SMILES | CCC[C@H]1OC(=O)[C@@H](OCOC)CC/C=C/[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H28O6/c1-5-8-12-15-13(22-17(2,3)23-15)9-6-7-10-14(16(18)21-12)20-11-19-4/h6,9,12-15H,5,7-8,10-11H2,1-4H3/b9-6+/t12-,13+,14+,15-/m1/s1 |
| InChIKey | UEFKQDLNRWWZLY-OYPWUHIQSA-N |
| XLogP | 2.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|