C16H24O6 — CID 11162732
[(1R)-1-[(4R,5S)-5-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate (PubChem CID 11162732) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-5-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate.
| Compound Name | [(1R)-1-[(4R,5S)-5-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate |
|---|---|
| PubChem CID | 11162732 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(1R)-1-[(4R,5S)-5-[(1R)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@H]1OC(C)(C)O[C@H]1[C@@H](C=C)OC(C)=O |
| InChI | InChI=1S/C16H24O6/c1-7-9-13(20-11(4)18)15-14(21-16(5,6)22-15)12(8-2)19-10(3)17/h7-8,12-15H,1-2,9H2,3-6H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | VUTGFKJNIDNNND-APIJFGDWSA-N |
| XLogP | 2.13 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|