C23H34O7 — CID 11560865
methyl (5Z,8Z)-10-[(4R,5S)-5-[(E,3S)-3-formyloxyoct-1-enyl]-2-oxo-1,3-dioxolan-4-yl]deca-5,8-dienoate (PubChem CID 11560865) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is methyl (5Z,8Z)-10-[(4R,5S)-5-[(E,3S)-3-formyloxyoct-1-enyl]-2-oxo-1,3-dioxolan-4-yl]deca-5,8-dienoate.
| Compound Name | methyl (5Z,8Z)-10-[(4R,5S)-5-[(E,3S)-3-formyloxyoct-1-enyl]-2-oxo-1,3-dioxolan-4-yl]deca-5,8-dienoate |
|---|---|
| PubChem CID | 11560865 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | methyl (5Z,8Z)-10-[(4R,5S)-5-[(E,3S)-3-formyloxyoct-1-enyl]-2-oxo-1,3-dioxolan-4-yl]deca-5,8-dienoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1OC(=O)O[C@@H]1C/C=C\C/C=C\CCCC(=O)OC)OC=O |
| InChI | InChI=1S/C23H34O7/c1-3-4-10-13-19(28-18-24)16-17-21-20(29-23(26)30-21)14-11-8-6-5-7-9-12-15-22(25)27-2/h5,7-8,11,16-21H,3-4,6,9-10,12-15H2,1-2H3/b7-5-,11-8-,17-16+/t19-,20+,21-/m0/s1 |
| InChIKey | IPUZBVWMOVNBLD-FIPDHBSTSA-N |
| XLogP | 4.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|