C16H16N2O2 — CID 10849496
[(1R,2R)-2-hydroxy-2-pyridin-2-ylcyclopentyl]-pyridin-2-ylmethanone (PubChem CID 10849496) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-2-pyridin-2-ylcyclopentyl]-pyridin-2-ylmethanone.
| Compound Name | [(1R,2R)-2-hydroxy-2-pyridin-2-ylcyclopentyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 10849496 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [(1R,2R)-2-hydroxy-2-pyridin-2-ylcyclopentyl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@@H]1CCC[C@]1(O)c1ccccn1 |
| InChI | InChI=1S/C16H16N2O2/c19-15(13-7-1-3-10-17-13)12-6-5-9-16(12,20)14-8-2-4-11-18-14/h1-4,7-8,10-12,20H,5-6,9H2/t12-,16+/m0/s1 |
| InChIKey | AAGUHZXWXNYZCM-BLLLJJGKSA-N |
| XLogP | 2.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |