C28H25N3O3 — CID 102440258
[(1R,2S,4S,6S)-2,4-dihydroxy-6-phenyl-2,4-dipyridin-2-ylcyclohexyl]-pyridin-2-ylmethanone (PubChem CID 102440258) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is [(1R,2S,4S,6S)-2,4-dihydroxy-6-phenyl-2,4-dipyridin-2-ylcyclohexyl]-pyridin-2-ylmethanone.
| Compound Name | [(1R,2S,4S,6S)-2,4-dihydroxy-6-phenyl-2,4-dipyridin-2-ylcyclohexyl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 102440258 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | [(1R,2S,4S,6S)-2,4-dihydroxy-6-phenyl-2,4-dipyridin-2-ylcyclohexyl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)[C@@H]1[C@@H](c2ccccc2)C[C@@](O)(c2ccccn2)C[C@@]1(O)c1ccccn1 |
| InChI | InChI=1S/C28H25N3O3/c32-26(22-12-4-7-15-29-22)25-21(20-10-2-1-3-11-20)18-27(33,23-13-5-8-16-30-23)19-28(25,34)24-14-6-9-17-31-24/h1-17,21,25,33-34H,18-19H2/t21-,25+,27+,28-/m1/s1 |
| InChIKey | KABFAHUBYVFQOM-NZHOUOPXSA-N |
| XLogP | 4.02 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |