C27H22N2O3 — CID 101031320
3,4-dihydroxy-2,5-diphenyl-3,4-dipyridin-2-ylcyclopentan-1-one (PubChem CID 101031320) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3,4-dihydroxy-2,5-diphenyl-3,4-dipyridin-2-ylcyclopentan-1-one.
| Compound Name | 3,4-dihydroxy-2,5-diphenyl-3,4-dipyridin-2-ylcyclopentan-1-one |
|---|---|
| PubChem CID | 101031320 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3,4-dihydroxy-2,5-diphenyl-3,4-dipyridin-2-ylcyclopentan-1-one |
| SMILES | O=C1C(c2ccccc2)C(O)(c2ccccn2)C(O)(c2ccccn2)C1c1ccccc1 |
| InChI | InChI=1S/C27H22N2O3/c30-25-23(19-11-3-1-4-12-19)26(31,21-15-7-9-17-28-21)27(32,22-16-8-10-18-29-22)24(25)20-13-5-2-6-14-20/h1-18,23-24,31-32H |
| InChIKey | ZHUDIVDFOOLRDC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |