C20H21Cl2N3O2 — CID 108500858
N-(2,3-dichlorophenyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 108500858) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108500858 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)Nc3cccc(Cl)c3Cl)CC2)c1C |
| InChI | InChI=1S/C20H21Cl2N3O2/c1-13-5-3-8-17(14(13)2)24-9-11-25(12-10-24)20(27)19(26)23-16-7-4-6-15(21)18(16)22/h3-8H,9-12H2,1-2H3,(H,23,26) |
| InChIKey | LJASBIKXJNRJPP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|