About N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide
N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide (PubChem CID 108503782) has the molecular formula C13H23N3O3
and a molecular weight of 269.34 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide.
Molecular Properties
| Compound Name | N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide |
| PubChem CID | 108503782 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide |
| SMILES | CN(C(=O)C(=O)N(C=O)CCCN)C1CCCCC1 |
| InChI | InChI=1S/C13H23N3O3/c1-15(11-6-3-2-4-7-11)12(18)13(19)16(10-17)9-5-8-14/h10-11H,2-9,14H2,1H3 |
| InChIKey | VVYWVEMPCQYRHU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide?
The IUPAC name of N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide (CID 108503782) is N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide.
What is the SMILES notation for N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide?
The canonical SMILES for N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide is CN(C(=O)C(=O)N(C=O)CCCN)C1CCCCC1.
What is the InChIKey of N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide?
The InChIKey is VVYWVEMPCQYRHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O3/c1-15(11-6-3-2-4-7-11)12(18)13(19)16(10-17)9-5-8-14/h10-11H,2-9,14H2,1H3.
What are the key properties of N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide?
N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide has a molecular weight of 269.34 g/mol, XLogP of 0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-aminopropyl)-N-cyclohexyl-N'-formyl-N-methyloxamide is sourced from PubChem (CID 108503782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).