C12H21N3O4 — CID 108504039
N-(3-aminopropyl)-2-(2,6-dimethylmorpholin-4-yl)-N-formyl-2-oxoacetamide (PubChem CID 108504039) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(2,6-dimethylmorpholin-4-yl)-N-formyl-2-oxoacetamide.
| Compound Name | N-(3-aminopropyl)-2-(2,6-dimethylmorpholin-4-yl)-N-formyl-2-oxoacetamide |
|---|---|
| PubChem CID | 108504039 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-(3-aminopropyl)-2-(2,6-dimethylmorpholin-4-yl)-N-formyl-2-oxoacetamide |
| SMILES | CC1CN(C(=O)C(=O)N(C=O)CCCN)CC(C)O1 |
| InChI | InChI=1S/C12H21N3O4/c1-9-6-15(7-10(2)19-9)12(18)11(17)14(8-16)5-3-4-13/h8-10H,3-7,13H2,1-2H3 |
| InChIKey | BFDRFOBYGQAKBJ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|