C15H24N4O4 — CID 108830944
ethyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]carbamate (PubChem CID 108830944) has the molecular formula C15H24N4O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]carbamate.
| Compound Name | ethyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]carbamate |
|---|---|
| PubChem CID | 108830944 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | ethyl N-(2-aminoethyl)-N-[(Z)-2-cyano-3-(2,6-dimethylmorpholin-4-yl)-3-oxoprop-1-enyl]carbamate |
| SMILES | CCOC(=O)N(/C=C(/C#N)C(=O)N1CC(C)OC(C)C1)CCN |
| InChI | InChI=1S/C15H24N4O4/c1-4-22-15(21)18(6-5-16)10-13(7-17)14(20)19-8-11(2)23-12(3)9-19/h10-12H,4-6,8-9,16H2,1-3H3/b13-10- |
| InChIKey | WSKKPFUHEZRUPF-RAXLEYEMSA-N |
| XLogP | 0.45 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|