C15H23N5O4 — CID 108841343
ethyl N-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate (PubChem CID 108841343) has the molecular formula C15H23N5O4 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl N-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate.
| Compound Name | ethyl N-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 108841343 |
| Molecular Formula | C15H23N5O4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | ethyl N-[(Z)-3-(4-acetylpiperazin-1-yl)-2-cyano-3-oxoprop-1-enyl]-N-(2-aminoethyl)carbamate |
| SMILES | CCOC(=O)N(/C=C(/C#N)C(=O)N1CCN(C(C)=O)CC1)CCN |
| InChI | InChI=1S/C15H23N5O4/c1-3-24-15(23)20(5-4-16)11-13(10-17)14(22)19-8-6-18(7-9-19)12(2)21/h11H,3-9,16H2,1-2H3/b13-11- |
| InChIKey | VNBPQFXVTCMCJZ-QBFSEMIESA-N |
| XLogP | -0.50 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|