C9H17N3O2 — CID 108910721
N-(3-aminopropyl)-N-[[(E)-but-1-enyl]carbamoyl]formamide (PubChem CID 108910721) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[[(E)-but-1-enyl]carbamoyl]formamide.
| Compound Name | N-(3-aminopropyl)-N-[[(E)-but-1-enyl]carbamoyl]formamide |
|---|---|
| PubChem CID | 108910721 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-(3-aminopropyl)-N-[[(E)-but-1-enyl]carbamoyl]formamide |
| SMILES | CC/C=C/NC(=O)N(C=O)CCCN |
| InChI | InChI=1S/C9H17N3O2/c1-2-3-6-11-9(14)12(8-13)7-4-5-10/h3,6,8H,2,4-5,7,10H2,1H3,(H,11,14)/b6-3+ |
| InChIKey | BYHRZTDJNMNOBW-ZZXKWVIFSA-N |
| XLogP | 0.43 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|