C15H19N3O5 — CID 108500130
ethyl 4-[[2-[3-aminopropyl(formyl)amino]-2-oxoacetyl]amino]benzoate (PubChem CID 108500130) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is ethyl 4-[[2-[3-aminopropyl(formyl)amino]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-aminopropyl(formyl)amino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108500130 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | ethyl 4-[[2-[3-aminopropyl(formyl)amino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=O)N(C=O)CCCN)cc1 |
| InChI | InChI=1S/C15H19N3O5/c1-2-23-15(22)11-4-6-12(7-5-11)17-13(20)14(21)18(10-19)9-3-8-16/h4-7,10H,2-3,8-9,16H2,1H3,(H,17,20) |
| InChIKey | BUWNPXBKMBEKMH-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|