C14H20N4O3 — CID 108528767
N'-(3-aminopropyl)-N-[3-(dimethylamino)phenyl]-N'-formyloxamide (PubChem CID 108528767) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N-[3-(dimethylamino)phenyl]-N'-formyloxamide.
| Compound Name | N'-(3-aminopropyl)-N-[3-(dimethylamino)phenyl]-N'-formyloxamide |
|---|---|
| PubChem CID | 108528767 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N'-(3-aminopropyl)-N-[3-(dimethylamino)phenyl]-N'-formyloxamide |
| SMILES | CN(C)c1cccc(NC(=O)C(=O)N(C=O)CCCN)c1 |
| InChI | InChI=1S/C14H20N4O3/c1-17(2)12-6-3-5-11(9-12)16-13(20)14(21)18(10-19)8-4-7-15/h3,5-6,9-10H,4,7-8,15H2,1-2H3,(H,16,20) |
| InChIKey | IEWYWCNARFCIEC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|