C12H13F2N3O3 — CID 108522067
N'-(3-aminopropyl)-N-(2,6-difluorophenyl)-N'-formyloxamide (PubChem CID 108522067) has the molecular formula C12H13F2N3O3 and a molecular weight of 285.25 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N-(2,6-difluorophenyl)-N'-formyloxamide.
| Compound Name | N'-(3-aminopropyl)-N-(2,6-difluorophenyl)-N'-formyloxamide |
|---|---|
| PubChem CID | 108522067 |
| Molecular Formula | C12H13F2N3O3 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N'-(3-aminopropyl)-N-(2,6-difluorophenyl)-N'-formyloxamide |
| SMILES | NCCCN(C=O)C(=O)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C12H13F2N3O3/c13-8-3-1-4-9(14)10(8)16-11(19)12(20)17(7-18)6-2-5-15/h1,3-4,7H,2,5-6,15H2,(H,16,19) |
| InChIKey | DNBBQBQSSQFHGF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|