C12H17N3O2 — CID 108887986
N-(3-aminopropyl)-N-[(3-methylphenyl)carbamoyl]formamide (PubChem CID 108887986) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-[(3-methylphenyl)carbamoyl]formamide.
| Compound Name | N-(3-aminopropyl)-N-[(3-methylphenyl)carbamoyl]formamide |
|---|---|
| PubChem CID | 108887986 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N-(3-aminopropyl)-N-[(3-methylphenyl)carbamoyl]formamide |
| SMILES | Cc1cccc(NC(=O)N(C=O)CCCN)c1 |
| InChI | InChI=1S/C12H17N3O2/c1-10-4-2-5-11(8-10)14-12(17)15(9-16)7-3-6-13/h2,4-5,8-9H,3,6-7,13H2,1H3,(H,14,17) |
| InChIKey | SOAJOPAMJOXCOO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|