C13H16BrN3O3 — CID 108528915
N'-(3-aminopropyl)-N-(4-bromo-3-methylphenyl)-N'-formyloxamide (PubChem CID 108528915) has the molecular formula C13H16BrN3O3 and a molecular weight of 342.19 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N-(4-bromo-3-methylphenyl)-N'-formyloxamide.
| Compound Name | N'-(3-aminopropyl)-N-(4-bromo-3-methylphenyl)-N'-formyloxamide |
|---|---|
| PubChem CID | 108528915 |
| Molecular Formula | C13H16BrN3O3 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N'-(3-aminopropyl)-N-(4-bromo-3-methylphenyl)-N'-formyloxamide |
| SMILES | Cc1cc(NC(=O)C(=O)N(C=O)CCCN)ccc1Br |
| InChI | InChI=1S/C13H16BrN3O3/c1-9-7-10(3-4-11(9)14)16-12(19)13(20)17(8-18)6-2-5-15/h3-4,7-8H,2,5-6,15H2,1H3,(H,16,19) |
| InChIKey | LKXXIYKHJIGLGE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|