C12H14IN3O3 — CID 108528869
N'-(3-aminopropyl)-N'-formyl-N-(4-iodophenyl)oxamide (PubChem CID 108528869) has the molecular formula C12H14IN3O3 and a molecular weight of 375.17 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-formyl-N-(4-iodophenyl)oxamide.
| Compound Name | N'-(3-aminopropyl)-N'-formyl-N-(4-iodophenyl)oxamide |
|---|---|
| PubChem CID | 108528869 |
| Molecular Formula | C12H14IN3O3 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | N'-(3-aminopropyl)-N'-formyl-N-(4-iodophenyl)oxamide |
| SMILES | NCCCN(C=O)C(=O)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H14IN3O3/c13-9-2-4-10(5-3-9)15-11(18)12(19)16(8-17)7-1-6-14/h2-5,8H,1,6-7,14H2,(H,15,18) |
| InChIKey | MKXNHSYWLCSPDI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|