C14H24N2O3 — CID 108503876
N-cyclohexyl-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide (PubChem CID 108503876) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide.
| Compound Name | N-cyclohexyl-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108503876 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-cyclohexyl-2-(2,6-dimethylmorpholin-4-yl)-2-oxoacetamide |
| SMILES | CC1CN(C(=O)C(=O)NC2CCCCC2)CC(C)O1 |
| InChI | InChI=1S/C14H24N2O3/c1-10-8-16(9-11(2)19-10)14(18)13(17)15-12-6-4-3-5-7-12/h10-12H,3-9H2,1-2H3,(H,15,17) |
| InChIKey | CCLATRHEAVEUNR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|