C12H22N2O4 — CID 108504128
2-(2,6-dimethylmorpholin-4-yl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-oxoacetamide (PubChem CID 108504128) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-oxoacetamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108504128 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-oxoacetamide |
| SMILES | CC1CN(C(=O)C(=O)NC(C)(C)CO)CC(C)O1 |
| InChI | InChI=1S/C12H22N2O4/c1-8-5-14(6-9(2)18-8)11(17)10(16)13-12(3,4)7-15/h8-9,15H,5-7H2,1-4H3,(H,13,16) |
| InChIKey | XGILQJIIWCAMKU-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|