C18H23ClN2O5 — CID 108504305
ethyl 1-[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoacetyl]piperidine-4-carboxylate (PubChem CID 108504305) has the molecular formula C18H23ClN2O5 and a molecular weight of 382.84 g/mol. Its IUPAC name is ethyl 1-[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108504305 |
| Molecular Formula | C18H23ClN2O5 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | ethyl 1-[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(=O)Nc2cc(C)c(Cl)cc2OC)CC1 |
| InChI | InChI=1S/C18H23ClN2O5/c1-4-26-18(24)12-5-7-21(8-6-12)17(23)16(22)20-14-9-11(2)13(19)10-15(14)25-3/h9-10,12H,4-8H2,1-3H3,(H,20,22) |
| InChIKey | MUVJWBALIUWNAX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|