C16H30N2O2 — CID 108504586
2-(4-methylpiperidin-1-yl)-2-oxo-N-(2,4,4-trimethylpentan-2-yl)acetamide (PubChem CID 108504586) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-2-oxo-N-(2,4,4-trimethylpentan-2-yl)acetamide.
| Compound Name | 2-(4-methylpiperidin-1-yl)-2-oxo-N-(2,4,4-trimethylpentan-2-yl)acetamide |
|---|---|
| PubChem CID | 108504586 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-2-oxo-N-(2,4,4-trimethylpentan-2-yl)acetamide |
| SMILES | CC1CCN(C(=O)C(=O)NC(C)(C)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30N2O2/c1-12-7-9-18(10-8-12)14(20)13(19)17-16(5,6)11-15(2,3)4/h12H,7-11H2,1-6H3,(H,17,19) |
| InChIKey | DGVLMHSQXDSTCZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|