C16H26N2O3 — CID 108509743
1-morpholin-4-yl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethane-1,2-dione (PubChem CID 108509743) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-morpholin-4-yl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethane-1,2-dione.
| Compound Name | 1-morpholin-4-yl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108509743 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-morpholin-4-yl-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)ethane-1,2-dione |
| SMILES | CC1(C)CC2CC(C)(CN2C(=O)C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C16H26N2O3/c1-15(2)8-12-9-16(3,10-15)11-18(12)14(20)13(19)17-4-6-21-7-5-17/h12H,4-11H2,1-3H3 |
| InChIKey | LRLJKARRCUUHSS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|