C18H21N3O4 — CID 108509880
N'-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)-N'-phenyloxamide (PubChem CID 108509880) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N'-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)-N'-phenyloxamide.
| Compound Name | N'-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 108509880 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N'-(4-aminophenyl)-N,N-bis(2-hydroxyethyl)-N'-phenyloxamide |
| SMILES | Nc1ccc(N(C(=O)C(=O)N(CCO)CCO)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O4/c19-14-6-8-16(9-7-14)21(15-4-2-1-3-5-15)18(25)17(24)20(10-12-22)11-13-23/h1-9,22-23H,10-13,19H2 |
| InChIKey | KPAIJKSKHNMYSE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|