C20H35N — CID 10851010
(4S,4aR)-4a,7,8-trimethyl-4-(6-methylhept-5-en-2-yl)-3,4,5,6,7,8-hexahydro-2H-quinoline (PubChem CID 10851010) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is (4S,4aR)-4a,7,8-trimethyl-4-(6-methylhept-5-en-2-yl)-3,4,5,6,7,8-hexahydro-2H-quinoline.
| Compound Name | (4S,4aR)-4a,7,8-trimethyl-4-(6-methylhept-5-en-2-yl)-3,4,5,6,7,8-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 10851010 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | (4S,4aR)-4a,7,8-trimethyl-4-(6-methylhept-5-en-2-yl)-3,4,5,6,7,8-hexahydro-2H-quinoline |
| SMILES | CC(C)=CCCC(C)[C@@H]1CCN=C2C(C)C(C)CC[C@@]21C |
| InChI | InChI=1S/C20H35N/c1-14(2)8-7-9-16(4)18-11-13-21-19-17(5)15(3)10-12-20(18,19)6/h8,15-18H,7,9-13H2,1-6H3/t15?,16?,17?,18-,20+/m0/s1 |
| InChIKey | ICVHVVIYTZBPSS-VZIDXPSOSA-N |
| XLogP | 5.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|