C26H43N — CID 91468143
(1R,3aS,3bS,9aR,9bS,11aR)-9a,11a-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,3a,3b,4,5,7,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline (PubChem CID 91468143) has the molecular formula C26H43N and a molecular weight of 369.64 g/mol. Its IUPAC name is (1R,3aS,3bS,9aR,9bS,11aR)-9a,11a-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,3a,3b,4,5,7,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline.
| Compound Name | (1R,3aS,3bS,9aR,9bS,11aR)-9a,11a-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,3a,3b,4,5,7,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline |
|---|---|
| PubChem CID | 91468143 |
| Molecular Formula | C26H43N |
| Molecular Weight | 369.64 g/mol |
| Exact Mass | 369.34 |
| IUPAC Name | (1R,3aS,3bS,9aR,9bS,11aR)-9a,11a-dimethyl-1-[(2R)-6-methylhept-5-en-2-yl]-2,3,3a,3b,4,5,7,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=NCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H43N/c1-18(2)8-6-9-19(3)21-11-12-22-20-10-13-24-26(5,15-7-17-27-24)23(20)14-16-25(21,22)4/h8,19-23H,6-7,9-17H2,1-5H3/t19-,20+,21-,22+,23+,25-,26-/m1/s1 |
| InChIKey | YPEIOSGFPYERSK-CEYJMKJVSA-N |
| XLogP | 7.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.64 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|