C28H46 — CID 134906962
(1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,8,15-trimethyl-14-(6-methylhept-5-en-2-yl)pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane (PubChem CID 134906962) has the molecular formula C28H46 and a molecular weight of 382.68 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,8,15-trimethyl-14-(6-methylhept-5-en-2-yl)pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane.
| Compound Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,8,15-trimethyl-14-(6-methylhept-5-en-2-yl)pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
|---|---|
| PubChem CID | 134906962 |
| Molecular Formula | C28H46 |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.36 |
| IUPAC Name | (1S,2R,5R,7R,8R,10S,11S,14R,15R)-2,8,15-trimethyl-14-(6-methylhept-5-en-2-yl)pentacyclo[8.7.0.02,7.05,7.011,15]heptadecane |
| SMILES | CC(C)=CCCC(C)[C@H]1CC[C@H]2[C@@H]3C[C@@H](C)[C@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H46/c1-18(2)8-7-9-19(3)23-10-11-24-22-16-20(4)28-17-21(28)12-15-27(28,6)25(22)13-14-26(23,24)5/h8,19-25H,7,9-17H2,1-6H3/t19?,20-,21-,22+,23-,24+,25+,26-,27-,28-/m1/s1 |
| InChIKey | LLSUXZXXNUHJOY-BEVYMQSCSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|