C27H45FO2 — CID 59110095
(3R,6S)-17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol (PubChem CID 59110095) has the molecular formula C27H45FO2 and a molecular weight of 420.65 g/mol. Its IUPAC name is (3R,6S)-17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol.
| Compound Name | (3R,6S)-17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
|---|---|
| PubChem CID | 59110095 |
| Molecular Formula | C27H45FO2 |
| Molecular Weight | 420.65 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | (3R,6S)-17-[(E)-7-fluoro-6-methylhept-5-en-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
| SMILES | C/C(=C\CCC(C)C1CCC2C3C[C@H](O)C4C[C@H](O)CCC4(C)C3CCC12C)CF |
| InChI | InChI=1S/C27H45FO2/c1-17(16-28)6-5-7-18(2)21-8-9-22-20-15-25(30)24-14-19(29)10-12-27(24,4)23(20)11-13-26(21,22)3/h6,18-25,29-30H,5,7-16H2,1-4H3/b17-6+/t18?,19-,20?,21?,22?,23?,24?,25+,26?,27?/m1/s1 |
| InChIKey | LUMTUGMVIZEEAZ-IUPMVTAKSA-N |
| XLogP | 6.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.65 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|