C27H46O3 — CID 163071212
(3R,6S,7R,10R,13R)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol (PubChem CID 163071212) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is (3R,6S,7R,10R,13R)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol.
| Compound Name | (3R,6S,7R,10R,13R)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol |
|---|---|
| PubChem CID | 163071212 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | (3R,6S,7R,10R,13R)-10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6,7-triol |
| SMILES | CC(C)=CCCC(C)C1CCC2C3C(O)[C@@H](O)C4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H46O3/c1-16(2)7-6-8-17(3)19-9-10-20-23-21(12-14-26(19,20)4)27(5)13-11-18(28)15-22(27)24(29)25(23)30/h7,17-25,28-30H,6,8-15H2,1-5H3/t17?,18-,19?,20?,21?,22?,23?,24+,25?,26-,27-/m1/s1 |
| InChIKey | HWNMKCKZWVCWCI-MDOGVOOZSA-N |
| XLogP | 5.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|