C26H47NO6S — CID 123762581
2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]ethanesulfonic acid (PubChem CID 123762581) has the molecular formula C26H47NO6S and a molecular weight of 501.73 g/mol. Its IUPAC name is 2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]ethanesulfonic acid.
| Compound Name | 2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 123762581 |
| Molecular Formula | C26H47NO6S |
| Molecular Weight | 501.73 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentylamino]ethanesulfonic acid |
| SMILES | CC(CCCNCCS(=O)(=O)O)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H47NO6S/c1-16(5-4-12-27-13-14-34(31,32)33)18-6-7-19-22-20(9-11-25(18,19)2)26(3)10-8-17(28)15-21(26)23(29)24(22)30/h16-24,27-30H,4-15H2,1-3H3,(H,31,32,33) |
| InChIKey | WHVACXRMFWSEDV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|