C29H48O4 — CID 91409410
ethyl 6-[(3R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate (PubChem CID 91409410) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is ethyl 6-[(3R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate.
| Compound Name | ethyl 6-[(3R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate |
|---|---|
| PubChem CID | 91409410 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | ethyl 6-[(3R,6S)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate |
| SMILES | CCOC(=O)C(C)=CCCC(C)C1CCC2C3C[C@H](O)C4C[C@H](O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H48O4/c1-6-33-27(32)19(3)9-7-8-18(2)22-10-11-23-21-17-26(31)25-16-20(30)12-14-29(25,5)24(21)13-15-28(22,23)4/h9,18,20-26,30-31H,6-8,10-17H2,1-5H3/t18?,20-,21?,22?,23?,24?,25?,26+,28?,29?/m1/s1 |
| InChIKey | XFQSFUPUGQFNDW-AJXTXTNNSA-N |
| XLogP | 5.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|