C20H22N4O3 — CID 108510594
N-(3H-benzimidazol-5-yl)-N'-[1-(2-ethoxy-5-methylphenyl)ethyl]oxamide (PubChem CID 108510594) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(3H-benzimidazol-5-yl)-N'-[1-(2-ethoxy-5-methylphenyl)ethyl]oxamide.
| Compound Name | N-(3H-benzimidazol-5-yl)-N'-[1-(2-ethoxy-5-methylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108510594 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(3H-benzimidazol-5-yl)-N'-[1-(2-ethoxy-5-methylphenyl)ethyl]oxamide |
| SMILES | CCOc1ccc(C)cc1C(C)NC(=O)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C20H22N4O3/c1-4-27-18-8-5-12(2)9-15(18)13(3)23-19(25)20(26)24-14-6-7-16-17(10-14)22-11-21-16/h5-11,13H,4H2,1-3H3,(H,21,22)(H,23,25)(H,24,26) |
| InChIKey | JDDGXVIZXVLUFK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|