About N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide
N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide (PubChem CID 108516076) has the molecular formula C13H11ClN4O2
and a molecular weight of 290.71 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide.
Molecular Properties
| Compound Name | N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide |
| PubChem CID | 108516076 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide |
| SMILES | Nc1ccc(NC(=O)C(=O)Nc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C13H11ClN4O2/c14-9-7-8(15)4-5-10(9)17-12(19)13(20)18-11-3-1-2-6-16-11/h1-7H,15H2,(H,17,19)(H,16,18,20) |
| InChIKey | VLDYRNIPYIKBIR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide?
The IUPAC name of N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide (CID 108516076) is N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide.
What is the SMILES notation for N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide?
The canonical SMILES for N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide is Nc1ccc(NC(=O)C(=O)Nc2ccccn2)c(Cl)c1.
What is the InChIKey of N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide?
The InChIKey is VLDYRNIPYIKBIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN4O2/c14-9-7-8(15)4-5-10(9)17-12(19)13(20)18-11-3-1-2-6-16-11/h1-7H,15H2,(H,17,19)(H,16,18,20).
What are the key properties of N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide?
N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide has a molecular weight of 290.71 g/mol, XLogP of 1.89, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2-chlorophenyl)-N'-pyridin-2-yloxamide is sourced from PubChem (CID 108516076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).