C17H20N2O2 — CID 108516838
2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxo-N,N-bis(prop-2-enyl)acetamide (PubChem CID 108516838) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxo-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxo-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 108516838 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxo-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)C(=O)N1c2ccccc2CC1C |
| InChI | InChI=1S/C17H20N2O2/c1-4-10-18(11-5-2)16(20)17(21)19-13(3)12-14-8-6-7-9-15(14)19/h4-9,13H,1-2,10-12H2,3H3 |
| InChIKey | OBBQEXCBQFUPSP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|