C26H26N2O3S — CID 132673892
N-[[4-(2-methyl-2,3-dihydroindole-1-carbonyl)phenyl]methyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 132673892) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[[4-(2-methyl-2,3-dihydroindole-1-carbonyl)phenyl]methyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[[4-(2-methyl-2,3-dihydroindole-1-carbonyl)phenyl]methyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 132673892 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[[4-(2-methyl-2,3-dihydroindole-1-carbonyl)phenyl]methyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(Cc1ccc(C(=O)N2c3ccccc3CC2C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-3-17-27(32(30,31)24-10-5-4-6-11-24)19-21-13-15-22(16-14-21)26(29)28-20(2)18-23-9-7-8-12-25(23)28/h3-16,20H,1,17-19H2,2H3 |
| InChIKey | NREQCIBICUJGCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|