C19H19FN2O3S — CID 134004891
2-fluoro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 134004891) has the molecular formula C19H19FN2O3S and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-fluoro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 2-fluoro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 134004891 |
| Molecular Formula | C19H19FN2O3S |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-fluoro-5-(2-methyl-2,3-dihydroindole-1-carbonyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)N2c3ccccc3CC2C)ccc1F |
| InChI | InChI=1S/C19H19FN2O3S/c1-3-10-21-26(24,25)18-12-15(8-9-16(18)20)19(23)22-13(2)11-14-6-4-5-7-17(14)22/h3-9,12-13,21H,1,10-11H2,2H3 |
| InChIKey | WEDKVEGUMOIPDE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|