C14H14ClN5O2S — CID 108520447
N-(2-chloro-3-pyridinyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide (PubChem CID 108520447) has the molecular formula C14H14ClN5O2S and a molecular weight of 351.82 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
|---|---|
| PubChem CID | 108520447 |
| Molecular Formula | C14H14ClN5O2S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)oxamide |
| SMILES | CN1CCc2nc(NC(=O)C(=O)Nc3cccnc3Cl)sc2C1 |
| InChI | InChI=1S/C14H14ClN5O2S/c1-20-6-4-8-10(7-20)23-14(18-8)19-13(22)12(21)17-9-3-2-5-16-11(9)15/h2-3,5H,4,6-7H2,1H3,(H,17,21)(H,18,19,22) |
| InChIKey | XEOGYIAWIBYLSU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|