C13H15N5O3S — CID 108523995
N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)oxamide (PubChem CID 108523995) has the molecular formula C13H15N5O3S and a molecular weight of 321.36 g/mol. Its IUPAC name is N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)oxamide.
| Compound Name | N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 108523995 |
| Molecular Formula | C13H15N5O3S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N'-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2nc3c(s2)CN(C)CC3)no1 |
| InChI | InChI=1S/C13H15N5O3S/c1-7-5-10(17-21-7)15-11(19)12(20)16-13-14-8-3-4-18(2)6-9(8)22-13/h5H,3-4,6H2,1-2H3,(H,14,16,20)(H,15,17,19) |
| InChIKey | XUURYLGGZJVLKB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|